C22H27O3P — CID 19595767
4-tert-butyl-2-cyclohexyl-6-hydroxybenzo[c][1,2]benzoxaphosphinine 6-oxide (PubChem CID 19595767) has the molecular formula C22H27O3P and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-tert-butyl-2-cyclohexyl-6-hydroxybenzo[c][1,2]benzoxaphosphinine 6-oxide.
| Compound Name | 4-tert-butyl-2-cyclohexyl-6-hydroxybenzo[c][1,2]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 19595767 |
| Molecular Formula | C22H27O3P |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-tert-butyl-2-cyclohexyl-6-hydroxybenzo[c][1,2]benzoxaphosphinine 6-oxide |
| SMILES | CC(C)(C)c1cc(C2CCCCC2)cc2c1OP(=O)(O)c1ccccc1-2 |
| InChI | InChI=1S/C22H27O3P/c1-22(2,3)19-14-16(15-9-5-4-6-10-15)13-18-17-11-7-8-12-20(17)26(23,24)25-21(18)19/h7-8,11-15H,4-6,9-10H2,1-3H3,(H,23,24) |
| InChIKey | PSZWQQDZBPPIRU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|