About 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide
7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 139761159) has the molecular formula C22H27O3P
and a molecular weight of 370.43 g/mol. Its IUPAC name is 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide.
Molecular Properties
| Compound Name | 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide |
| PubChem CID | 139761159 |
| Molecular Formula | C22H27O3P |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | CC(C)(C)c1cc(C2CCCCC2)cc2c1P(=O)(O)Oc1ccccc1-2 |
| InChI | InChI=1S/C22H27O3P/c1-22(2,3)19-14-16(15-9-5-4-6-10-15)13-18-17-11-7-8-12-20(17)25-26(23,24)21(18)19/h7-8,11-15H,4-6,9-10H2,1-3H3,(H,23,24) |
| InChIKey | JBJYYAXLZCGIKJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide?
The IUPAC name of 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide (CID 139761159) is 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide.
What is the SMILES notation for 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide?
The canonical SMILES for 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide is CC(C)(C)c1cc(C2CCCCC2)cc2c1P(=O)(O)Oc1ccccc1-2.
What is the InChIKey of 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide?
The InChIKey is JBJYYAXLZCGIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27O3P/c1-22(2,3)19-14-16(15-9-5-4-6-10-15)13-18-17-11-7-8-12-20(17)25-26(23,24)21(18)19/h7-8,11-15H,4-6,9-10H2,1-3H3,(H,23,24).
What are the key properties of 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide?
7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide has a molecular weight of 370.43 g/mol, XLogP of 5.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-9-cyclohexyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide is sourced from PubChem (CID 139761159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).