C16H17O3P — CID 54497400
7-butyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 54497400) has the molecular formula C16H17O3P and a molecular weight of 288.28 g/mol. Its IUPAC name is 7-butyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | 7-butyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 54497400 |
| Molecular Formula | C16H17O3P |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 7-butyl-6-hydroxybenzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | CCCCc1cccc2c1P(=O)(O)Oc1ccccc1-2 |
| InChI | InChI=1S/C16H17O3P/c1-2-3-7-12-8-6-10-14-13-9-4-5-11-15(13)19-20(17,18)16(12)14/h4-6,8-11H,2-3,7H2,1H3,(H,17,18) |
| InChIKey | YABXCOMZTUHYKH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|