C42H52O2 — CID 157497488
4-(4-cyclopentylphenyl)phenol;2,6-ditert-butyl-4-(4-cyclopentylphenyl)phenol (PubChem CID 157497488) has the molecular formula C42H52O2 and a molecular weight of 588.88 g/mol. Its IUPAC name is 4-(4-cyclopentylphenyl)phenol;2,6-ditert-butyl-4-(4-cyclopentylphenyl)phenol.
| Compound Name | 4-(4-cyclopentylphenyl)phenol;2,6-ditert-butyl-4-(4-cyclopentylphenyl)phenol |
|---|---|
| PubChem CID | 157497488 |
| Molecular Formula | C42H52O2 |
| Molecular Weight | 588.88 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | 4-(4-cyclopentylphenyl)phenol;2,6-ditert-butyl-4-(4-cyclopentylphenyl)phenol |
| SMILES | CC(C)(C)c1cc(-c2ccc(C3CCCC3)cc2)cc(C(C)(C)C)c1O.Oc1ccc(-c2ccc(C3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H34O.C17H18O/c1-24(2,3)21-15-20(16-22(23(21)26)25(4,5)6)19-13-11-18(12-14-19)17-9-7-8-10-17;18-17-11-9-16(10-12-17)15-7-5-14(6-8-15)13-3-1-2-4-13/h11-17,26H,7-10H2,1-6H3;5-13,18H,1-4H2 |
| InChIKey | BXZUBLBITVENGH-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.88 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |