C41H46O4 — CID 165040485
2-[(4-cyclohexylphenyl)-[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]-4-(4-hydroxyphenyl)phenol;ethane (PubChem CID 165040485) has the molecular formula C41H46O4 and a molecular weight of 602.82 g/mol. Its IUPAC name is 2-[(4-cyclohexylphenyl)-[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]-4-(4-hydroxyphenyl)phenol;ethane.
| Compound Name | 2-[(4-cyclohexylphenyl)-[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]-4-(4-hydroxyphenyl)phenol;ethane |
|---|---|
| PubChem CID | 165040485 |
| Molecular Formula | C41H46O4 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | 2-[(4-cyclohexylphenyl)-[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]-4-(4-hydroxyphenyl)phenol;ethane |
| SMILES | CC.CC.Oc1ccc(-c2ccc(O)c(C(c3ccc(C4CCCCC4)cc3)c3cc(-c4ccc(O)cc4)ccc3O)c2)cc1 |
| InChI | InChI=1S/C37H34O4.2C2H6/c38-31-16-10-26(11-17-31)29-14-20-35(40)33(22-29)37(28-8-6-25(7-9-28)24-4-2-1-3-5-24)34-23-30(15-21-36(34)41)27-12-18-32(39)19-13-27;2*1-2/h6-24,37-41H,1-5H2;2*1-2H3 |
| InChIKey | OAUWVYBELHVGSP-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|