C62H46O7 — CID 126693552
2-[[4-[4-[bis[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]phenyl]phenyl]-[3-(4-hydroxyphenyl)phenyl]methyl]-4-(4-hydroxyphenyl)phenol (PubChem CID 126693552) has the molecular formula C62H46O7 and a molecular weight of 903.04 g/mol. Its IUPAC name is 2-[[4-[4-[bis[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]phenyl]phenyl]-[3-(4-hydroxyphenyl)phenyl]methyl]-4-(4-hydroxyphenyl)phenol.
| Compound Name | 2-[[4-[4-[bis[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]phenyl]phenyl]-[3-(4-hydroxyphenyl)phenyl]methyl]-4-(4-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 126693552 |
| Molecular Formula | C62H46O7 |
| Molecular Weight | 903.04 g/mol |
| Exact Mass | 902.32 |
| IUPAC Name | 2-[[4-[4-[bis[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]phenyl]phenyl]-[3-(4-hydroxyphenyl)phenyl]methyl]-4-(4-hydroxyphenyl)phenol |
| SMILES | Oc1ccc(-c2cccc(C(c3ccc(-c4ccc(C(c5cc(-c6ccc(O)cc6)ccc5O)c5cc(-c6ccc(O)cc6)ccc5O)cc4)cc3)c3cc(-c4ccc(O)cc4)ccc3O)c2)cc1 |
| InChI | InChI=1S/C62H46O7/c63-51-23-12-40(13-24-51)46-2-1-3-50(34-46)61(55-35-47(20-31-58(55)67)41-14-25-52(64)26-15-41)44-8-4-38(5-9-44)39-6-10-45(11-7-39)62(56-36-48(21-32-59(56)68)42-16-27-53(65)28-17-42)57-37-49(22-33-60(57)69)43-18-29-54(66)30-19-43/h1-37,61-69H |
| InChIKey | XATLQHPHDRANEK-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.04 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|