C29H21IO5 — CID 126698405
2-[[2-hydroxy-5-(4-hydroxyphenyl)phenyl]-(5-iodofuran-2-yl)methyl]-4-(4-hydroxyphenyl)phenol (PubChem CID 126698405) has the molecular formula C29H21IO5 and a molecular weight of 576.39 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-(4-hydroxyphenyl)phenyl]-(5-iodofuran-2-yl)methyl]-4-(4-hydroxyphenyl)phenol.
| Compound Name | 2-[[2-hydroxy-5-(4-hydroxyphenyl)phenyl]-(5-iodofuran-2-yl)methyl]-4-(4-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 126698405 |
| Molecular Formula | C29H21IO5 |
| Molecular Weight | 576.39 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | 2-[[2-hydroxy-5-(4-hydroxyphenyl)phenyl]-(5-iodofuran-2-yl)methyl]-4-(4-hydroxyphenyl)phenol |
| SMILES | Oc1ccc(-c2ccc(O)c(C(c3ccc(I)o3)c3cc(-c4ccc(O)cc4)ccc3O)c2)cc1 |
| InChI | InChI=1S/C29H21IO5/c30-28-14-13-27(35-28)29(23-15-19(5-11-25(23)33)17-1-7-21(31)8-2-17)24-16-20(6-12-26(24)34)18-3-9-22(32)10-4-18/h1-16,29,31-34H |
| InChIKey | NVGHFBMNAIMYJF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.39 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|