C34H28O4 — CID 163458586
2-[[2-hydroxy-5-(4-hydroxyphenyl)phenyl]-[4-[(E)-prop-1-enyl]phenyl]methyl]-4-(4-hydroxyphenyl)phenol (PubChem CID 163458586) has the molecular formula C34H28O4 and a molecular weight of 500.59 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-(4-hydroxyphenyl)phenyl]-[4-[(E)-prop-1-enyl]phenyl]methyl]-4-(4-hydroxyphenyl)phenol.
| Compound Name | 2-[[2-hydroxy-5-(4-hydroxyphenyl)phenyl]-[4-[(E)-prop-1-enyl]phenyl]methyl]-4-(4-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 163458586 |
| Molecular Formula | C34H28O4 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-[[2-hydroxy-5-(4-hydroxyphenyl)phenyl]-[4-[(E)-prop-1-enyl]phenyl]methyl]-4-(4-hydroxyphenyl)phenol |
| SMILES | C/C=C/c1ccc(C(c2cc(-c3ccc(O)cc3)ccc2O)c2cc(-c3ccc(O)cc3)ccc2O)cc1 |
| InChI | InChI=1S/C34H28O4/c1-2-3-22-4-6-25(7-5-22)34(30-20-26(12-18-32(30)37)23-8-14-28(35)15-9-23)31-21-27(13-19-33(31)38)24-10-16-29(36)17-11-24/h2-21,34-38H,1H3/b3-2+ |
| InChIKey | BMQGVXQBHMPKFZ-NSCUHMNNSA-N |
| XLogP | 8.06 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|