C57H44O7 — CID 167172806
2-[(3E,5Z)-1-[4-[bis[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]phenyl]-4-(4-hydroxyphenyl)octa-3,5-dien-7-ynyl]-4-(4-hydroxyphenyl)phenol (PubChem CID 167172806) has the molecular formula C57H44O7 and a molecular weight of 840.97 g/mol. Its IUPAC name is 2-[(3E,5Z)-1-[4-[bis[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]phenyl]-4-(4-hydroxyphenyl)octa-3,5-dien-7-ynyl]-4-(4-hydroxyphenyl)phenol.
| Compound Name | 2-[(3E,5Z)-1-[4-[bis[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]phenyl]-4-(4-hydroxyphenyl)octa-3,5-dien-7-ynyl]-4-(4-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 167172806 |
| Molecular Formula | C57H44O7 |
| Molecular Weight | 840.97 g/mol |
| Exact Mass | 840.31 |
| IUPAC Name | 2-[(3E,5Z)-1-[4-[bis[2-hydroxy-5-(4-hydroxyphenyl)phenyl]methyl]phenyl]-4-(4-hydroxyphenyl)octa-3,5-dien-7-ynyl]-4-(4-hydroxyphenyl)phenol |
| SMILES | C#C/C=C\C(=C/CC(c1ccc(C(c2cc(-c3ccc(O)cc3)ccc2O)c2cc(-c3ccc(O)cc3)ccc2O)cc1)c1cc(-c2ccc(O)cc2)ccc1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C57H44O7/c1-2-3-4-36(37-9-21-46(58)22-10-37)17-29-50(51-33-43(18-30-54(51)62)38-11-23-47(59)24-12-38)41-5-7-42(8-6-41)57(52-34-44(19-31-55(52)63)39-13-25-48(60)26-14-39)53-35-45(20-32-56(53)64)40-15-27-49(61)28-16-40/h1,3-28,30-35,50,57-64H,29H2/b4-3-,36-17+ |
| InChIKey | CEADLIVGGJWBBR-RZBNCNEKSA-N |
| XLogP | 12.60 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.97 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|