C26H34O2 — CID 139930956
2,6-ditert-butyl-4-[4-(4-hydroxyphenyl)cyclohexen-1-yl]phenol (PubChem CID 139930956) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[4-(4-hydroxyphenyl)cyclohexen-1-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[4-(4-hydroxyphenyl)cyclohexen-1-yl]phenol |
|---|---|
| PubChem CID | 139930956 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 2,6-ditert-butyl-4-[4-(4-hydroxyphenyl)cyclohexen-1-yl]phenol |
| SMILES | CC(C)(C)c1cc(C2=CCC(c3ccc(O)cc3)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H34O2/c1-25(2,3)22-15-20(16-23(24(22)28)26(4,5)6)19-9-7-17(8-10-19)18-11-13-21(27)14-12-18/h9,11-17,27-28H,7-8,10H2,1-6H3 |
| InChIKey | PYGJYRJVYMUGFO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |