C25H24O2 — CID 141265705
4-[4-(4-hydroxyphenyl)cyclohexen-1-yl]-2-methyl-6-phenylphenol (PubChem CID 141265705) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)cyclohexen-1-yl]-2-methyl-6-phenylphenol.
| Compound Name | 4-[4-(4-hydroxyphenyl)cyclohexen-1-yl]-2-methyl-6-phenylphenol |
|---|---|
| PubChem CID | 141265705 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)cyclohexen-1-yl]-2-methyl-6-phenylphenol |
| SMILES | Cc1cc(C2=CCC(c3ccc(O)cc3)CC2)cc(-c2ccccc2)c1O |
| InChI | InChI=1S/C25H24O2/c1-17-15-22(16-24(25(17)27)21-5-3-2-4-6-21)20-9-7-18(8-10-20)19-11-13-23(26)14-12-19/h2-6,9,11-16,18,26-27H,7-8,10H2,1H3 |
| InChIKey | VFQIWPHWEYFQHU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |