C19H19F — CID 134256168
4-fluoro-2-methyl-1-(4-phenylcyclohexen-1-yl)benzene (PubChem CID 134256168) has the molecular formula C19H19F and a molecular weight of 266.36 g/mol. Its IUPAC name is 4-fluoro-2-methyl-1-(4-phenylcyclohexen-1-yl)benzene.
| Compound Name | 4-fluoro-2-methyl-1-(4-phenylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 134256168 |
| Molecular Formula | C19H19F |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-fluoro-2-methyl-1-(4-phenylcyclohexen-1-yl)benzene |
| SMILES | Cc1cc(F)ccc1C1=CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19F/c1-14-13-18(20)11-12-19(14)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-6,9,11-13,16H,7-8,10H2,1H3 |
| InChIKey | KIZPSCAEMGSRSS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |