C20H18S2 — CID 122234023
2-(4-phenylcyclohexen-1-yl)-5-thiophen-2-ylthiophene (PubChem CID 122234023) has the molecular formula C20H18S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 2-(4-phenylcyclohexen-1-yl)-5-thiophen-2-ylthiophene.
| Compound Name | 2-(4-phenylcyclohexen-1-yl)-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 122234023 |
| Molecular Formula | C20H18S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-(4-phenylcyclohexen-1-yl)-5-thiophen-2-ylthiophene |
| SMILES | C1=C(c2ccc(-c3cccs3)s2)CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C20H18S2/c1-2-5-15(6-3-1)16-8-10-17(11-9-16)18-12-13-20(22-18)19-7-4-14-21-19/h1-7,10,12-14,16H,8-9,11H2 |
| InChIKey | MAFFUSLVCJPADH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |