C13H15NO — CID 86313094
N-[(4S)-4-phenylcyclohexen-1-yl]formamide (PubChem CID 86313094) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[(4S)-4-phenylcyclohexen-1-yl]formamide.
| Compound Name | N-[(4S)-4-phenylcyclohexen-1-yl]formamide |
|---|---|
| PubChem CID | 86313094 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-[(4S)-4-phenylcyclohexen-1-yl]formamide |
| SMILES | O=CNC1=CC[C@@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C13H15NO/c15-10-14-13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-5,8,10,12H,6-7,9H2,(H,14,15)/t12-/m1/s1 |
| InChIKey | PDCDNRRTCNPVES-GFCCVEGCSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|