C20H21BrN2O2 — CID 2400029
2-(3-bromophenoxy)-N'-[(4S)-4-phenylcyclohexen-1-yl]acetohydrazide (PubChem CID 2400029) has the molecular formula C20H21BrN2O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N'-[(4S)-4-phenylcyclohexen-1-yl]acetohydrazide.
| Compound Name | 2-(3-bromophenoxy)-N'-[(4S)-4-phenylcyclohexen-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 2400029 |
| Molecular Formula | C20H21BrN2O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-(3-bromophenoxy)-N'-[(4S)-4-phenylcyclohexen-1-yl]acetohydrazide |
| SMILES | O=C(COc1cccc(Br)c1)NNC1=CC[C@@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21BrN2O2/c21-17-7-4-8-19(13-17)25-14-20(24)23-22-18-11-9-16(10-12-18)15-5-2-1-3-6-15/h1-8,11,13,16,22H,9-10,12,14H2,(H,23,24)/t16-/m1/s1 |
| InChIKey | OZFLBUGYJCDOGA-MRXNPFEDSA-N |
| XLogP | 4.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|