C24H30N2O2 — CID 2391704
2-(4-methyl-2-propan-2-ylphenoxy)-N'-[(4S)-4-phenylcyclohexen-1-yl]acetohydrazide (PubChem CID 2391704) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-(4-methyl-2-propan-2-ylphenoxy)-N'-[(4S)-4-phenylcyclohexen-1-yl]acetohydrazide.
| Compound Name | 2-(4-methyl-2-propan-2-ylphenoxy)-N'-[(4S)-4-phenylcyclohexen-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 2391704 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-(4-methyl-2-propan-2-ylphenoxy)-N'-[(4S)-4-phenylcyclohexen-1-yl]acetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC2=CC[C@@H](c3ccccc3)CC2)c(C(C)C)c1 |
| InChI | InChI=1S/C24H30N2O2/c1-17(2)22-15-18(3)9-14-23(22)28-16-24(27)26-25-21-12-10-20(11-13-21)19-7-5-4-6-8-19/h4-9,12,14-15,17,20,25H,10-11,13,16H2,1-3H3,(H,26,27)/t20-/m1/s1 |
| InChIKey | UHHURZDAHBEOLK-HXUWFJFHSA-N |
| XLogP | 4.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|