C19H20N2O2 — CID 2367765
N'-(cyclopenten-1-yl)-2-(2-phenylphenoxy)acetohydrazide (PubChem CID 2367765) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N'-(cyclopenten-1-yl)-2-(2-phenylphenoxy)acetohydrazide.
| Compound Name | N'-(cyclopenten-1-yl)-2-(2-phenylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 2367765 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N'-(cyclopenten-1-yl)-2-(2-phenylphenoxy)acetohydrazide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC1=CCCC1 |
| InChI | InChI=1S/C19H20N2O2/c22-19(21-20-16-10-4-5-11-16)14-23-18-13-7-6-12-17(18)15-8-2-1-3-9-15/h1-3,6-10,12-13,20H,4-5,11,14H2,(H,21,22) |
| InChIKey | PLQWVWOGHHWZCB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|