C21H24N2O2 — CID 2378280
N'-[(4S)-4-methylcyclohexen-1-yl]-2-(2-phenylphenoxy)acetohydrazide (PubChem CID 2378280) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N'-[(4S)-4-methylcyclohexen-1-yl]-2-(2-phenylphenoxy)acetohydrazide.
| Compound Name | N'-[(4S)-4-methylcyclohexen-1-yl]-2-(2-phenylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 2378280 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N'-[(4S)-4-methylcyclohexen-1-yl]-2-(2-phenylphenoxy)acetohydrazide |
| SMILES | C[C@@H]1CC=C(NNC(=O)COc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N2O2/c1-16-11-13-18(14-12-16)22-23-21(24)15-25-20-10-6-5-9-19(20)17-7-3-2-4-8-17/h2-10,13,16,22H,11-12,14-15H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | MJHPGAFJEARANE-MRXNPFEDSA-N |
| XLogP | 4.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|