C18H20N2O2 — CID 2386188
2-methyl-N'-[(4R)-4-phenylcyclohexen-1-yl]furan-3-carbohydrazide (PubChem CID 2386188) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-methyl-N'-[(4R)-4-phenylcyclohexen-1-yl]furan-3-carbohydrazide.
| Compound Name | 2-methyl-N'-[(4R)-4-phenylcyclohexen-1-yl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 2386188 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-methyl-N'-[(4R)-4-phenylcyclohexen-1-yl]furan-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC1=CC[C@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C18H20N2O2/c1-13-17(11-12-22-13)18(21)20-19-16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-6,9,11-12,15,19H,7-8,10H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | UKMDBVFUTBLYKK-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|