C18H14KO3P — CID 173353051
potassium;hydride;6-hydroxy-2-phenylbenzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 173353051) has the molecular formula C18H14KO3P and a molecular weight of 348.38 g/mol. Its IUPAC name is potassium;hydride;6-hydroxy-2-phenylbenzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | potassium;hydride;6-hydroxy-2-phenylbenzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 173353051 |
| Molecular Formula | C18H14KO3P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | potassium;hydride;6-hydroxy-2-phenylbenzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | O=P1(O)Oc2ccc(-c3ccccc3)cc2-c2ccccc21.[H-].[K+] |
| InChI | InChI=1S/C18H13O3P.K.H/c19-22(20)18-9-5-4-8-15(18)16-12-14(10-11-17(16)21-22)13-6-2-1-3-7-13;;/h1-12H,(H,19,20);;/q;+1;-1 |
| InChIKey | WTEWUNWBKVFODT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|