C30H29O3P — CID 19595811
6-hydroxy-2,8-bis(2-phenylpropan-2-yl)benzo[c][1,2]benzoxaphosphinine 6-oxide (PubChem CID 19595811) has the molecular formula C30H29O3P and a molecular weight of 468.53 g/mol. Its IUPAC name is 6-hydroxy-2,8-bis(2-phenylpropan-2-yl)benzo[c][1,2]benzoxaphosphinine 6-oxide.
| Compound Name | 6-hydroxy-2,8-bis(2-phenylpropan-2-yl)benzo[c][1,2]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 19595811 |
| Molecular Formula | C30H29O3P |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6-hydroxy-2,8-bis(2-phenylpropan-2-yl)benzo[c][1,2]benzoxaphosphinine 6-oxide |
| SMILES | CC(C)(c1ccccc1)c1ccc2c(c1)-c1ccc(C(C)(C)c3ccccc3)cc1P(=O)(O)O2 |
| InChI | InChI=1S/C30H29O3P/c1-29(2,21-11-7-5-8-12-21)23-16-18-27-26(19-23)25-17-15-24(20-28(25)34(31,32)33-27)30(3,4)22-13-9-6-10-14-22/h5-20H,1-4H3,(H,31,32) |
| InChIKey | CIRMSZAIMGZQLS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|