C30H44LiO4P — CID 69257425
lithium 2,4,8,10-tetratert-butyl-6-oxido-12,13-dihydrobenzo[d][1,3,2]benzodioxaphosphonine 6-oxide (PubChem CID 69257425) has the molecular formula C30H44LiO4P and a molecular weight of 506.59 g/mol. Its IUPAC name is lithium 2,4,8,10-tetratert-butyl-6-oxido-12,13-dihydrobenzo[d][1,3,2]benzodioxaphosphonine 6-oxide.
| Compound Name | lithium 2,4,8,10-tetratert-butyl-6-oxido-12,13-dihydrobenzo[d][1,3,2]benzodioxaphosphonine 6-oxide |
|---|---|
| PubChem CID | 69257425 |
| Molecular Formula | C30H44LiO4P |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | lithium 2,4,8,10-tetratert-butyl-6-oxido-12,13-dihydrobenzo[d][1,3,2]benzodioxaphosphonine 6-oxide |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OP(=O)([O-])Oc1c(cc(C(C)(C)C)cc1C(C)(C)C)CC2.[Li+] |
| InChI | InChI=1S/C30H45O4P.Li/c1-27(2,3)21-15-19-13-14-20-16-22(28(4,5)6)18-24(30(10,11)12)26(20)34-35(31,32)33-25(19)23(17-21)29(7,8)9;/h15-18H,13-14H2,1-12H3,(H,31,32);/q;+1/p-1 |
| InChIKey | YVCGQXYEXWJFED-UHFFFAOYSA-M |
| XLogP | 4.91 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|