C44H63O6P — CID 139605738
2-[(1,3,7,9-tetratert-butyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]ethyl 3-(3-tert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 139605738) has the molecular formula C44H63O6P and a molecular weight of 718.96 g/mol. Its IUPAC name is 2-[(1,3,7,9-tetratert-butyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]ethyl 3-(3-tert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 2-[(1,3,7,9-tetratert-butyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]ethyl 3-(3-tert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 139605738 |
| Molecular Formula | C44H63O6P |
| Molecular Weight | 718.96 g/mol |
| Exact Mass | 718.44 |
| IUPAC Name | 2-[(1,3,7,9-tetratert-butyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]ethyl 3-(3-tert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OP(OCCOC(=O)CCc1ccc(O)c(C(C)(C)C)c1)Oc1c(cc(C(C)(C)C)cc1C(C)(C)C)C2 |
| InChI | InChI=1S/C44H63O6P/c1-40(2,3)31-24-29-23-30-25-32(41(4,5)6)27-35(44(13,14)15)39(30)50-51(49-38(29)34(26-31)43(10,11)12)48-21-20-47-37(46)19-17-28-16-18-36(45)33(22-28)42(7,8)9/h16,18,22,24-27,45H,17,19-21,23H2,1-15H3 |
| InChIKey | SHHPRDNWBCADDI-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.96 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|