C44H63O6P — CID 11136318
2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate (PubChem CID 11136318) has the molecular formula C44H63O6P and a molecular weight of 718.96 g/mol. Its IUPAC name is 2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate.
| Compound Name | 2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 11136318 |
| Molecular Formula | C44H63O6P |
| Molecular Weight | 718.96 g/mol |
| Exact Mass | 718.44 |
| IUPAC Name | 2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
| SMILES | Cc1cc(CCC(=O)OCCOp2oc3c(C(C)(C)C)cc(C(C)(C)C)cc3c3cc(C(C)(C)C)cc(C(C)(C)C)c3o2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C44H63O6P/c1-27-21-28(22-33(37(27)46)42(8,9)10)17-18-36(45)47-19-20-48-51-49-38-31(23-29(40(2,3)4)25-34(38)43(11,12)13)32-24-30(41(5,6)7)26-35(39(32)50-51)44(14,15)16/h21-26,46H,17-20H2,1-16H3 |
| InChIKey | LGOBNHVUZCAFQO-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.96 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|