C45H65O6P — CID 139758292
2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl 3-(3-tert-butyl-4-methoxy-5-methylphenyl)propanoate (PubChem CID 139758292) has the molecular formula C45H65O6P and a molecular weight of 732.98 g/mol. Its IUPAC name is 2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl 3-(3-tert-butyl-4-methoxy-5-methylphenyl)propanoate.
| Compound Name | 2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl 3-(3-tert-butyl-4-methoxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 139758292 |
| Molecular Formula | C45H65O6P |
| Molecular Weight | 732.98 g/mol |
| Exact Mass | 732.45 |
| IUPAC Name | 2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethyl 3-(3-tert-butyl-4-methoxy-5-methylphenyl)propanoate |
| SMILES | COc1c(C)cc(CCC(=O)OCCOp2oc3c(C(C)(C)C)cc(C(C)(C)C)cc3c3cc(C(C)(C)C)cc(C(C)(C)C)c3o2)cc1C(C)(C)C |
| InChI | InChI=1S/C45H65O6P/c1-28-22-29(23-34(38(28)47-17)43(8,9)10)18-19-37(46)48-20-21-49-52-50-39-32(24-30(41(2,3)4)26-35(39)44(11,12)13)33-25-31(42(5,6)7)27-36(40(33)51-52)45(14,15)16/h22-27H,18-21H2,1-17H3 |
| InChIKey | LSTAOIBWICTGIV-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.98 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|