C18H28O4 — CID 21199855
2-hydroxyethyl 3-(3-tert-butyl-5-ethyl-4-methoxyphenyl)propanoate (PubChem CID 21199855) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-hydroxyethyl 3-(3-tert-butyl-5-ethyl-4-methoxyphenyl)propanoate.
| Compound Name | 2-hydroxyethyl 3-(3-tert-butyl-5-ethyl-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 21199855 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-hydroxyethyl 3-(3-tert-butyl-5-ethyl-4-methoxyphenyl)propanoate |
| SMILES | CCc1cc(CCC(=O)OCCO)cc(C(C)(C)C)c1OC |
| InChI | InChI=1S/C18H28O4/c1-6-14-11-13(7-8-16(20)22-10-9-19)12-15(17(14)21-5)18(2,3)4/h11-12,19H,6-10H2,1-5H3 |
| InChIKey | WVIAGQQAIZFGSN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |