C21H36O5Si — CID 155766031
3-[dimethoxy(methyl)silyl]propyl 3-(3-tert-butyl-5-ethyl-4-hydroxyphenyl)propanoate (PubChem CID 155766031) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propyl 3-(3-tert-butyl-5-ethyl-4-hydroxyphenyl)propanoate.
| Compound Name | 3-[dimethoxy(methyl)silyl]propyl 3-(3-tert-butyl-5-ethyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 155766031 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propyl 3-(3-tert-butyl-5-ethyl-4-hydroxyphenyl)propanoate |
| SMILES | CCc1cc(CCC(=O)OCCC[Si](C)(OC)OC)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H36O5Si/c1-8-17-14-16(15-18(20(17)23)21(2,3)4)10-11-19(22)26-12-9-13-27(7,24-5)25-6/h14-15,23H,8-13H2,1-7H3 |
| InChIKey | AAWRGFYAPBUABT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|