C38H61O2P — CID 152582969
1,3,7,9-tetratert-butyl-11-(6-methylheptoxy)-5,12-dihydrobenzo[d][1,2]benzoxaphosphocine (PubChem CID 152582969) has the molecular formula C38H61O2P and a molecular weight of 580.88 g/mol. Its IUPAC name is 1,3,7,9-tetratert-butyl-11-(6-methylheptoxy)-5,12-dihydrobenzo[d][1,2]benzoxaphosphocine.
| Compound Name | 1,3,7,9-tetratert-butyl-11-(6-methylheptoxy)-5,12-dihydrobenzo[d][1,2]benzoxaphosphocine |
|---|---|
| PubChem CID | 152582969 |
| Molecular Formula | C38H61O2P |
| Molecular Weight | 580.88 g/mol |
| Exact Mass | 580.44 |
| IUPAC Name | 1,3,7,9-tetratert-butyl-11-(6-methylheptoxy)-5,12-dihydrobenzo[d][1,2]benzoxaphosphocine |
| SMILES | CC(C)CCCCCOP1Cc2c(cc(C(C)(C)C)cc2C(C)(C)C)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C38H61O2P/c1-26(2)18-16-15-17-19-39-41-25-31-27(21-29(35(3,4)5)23-32(31)37(9,10)11)20-28-22-30(36(6,7)8)24-33(34(28)40-41)38(12,13)14/h21-24,26H,15-20,25H2,1-14H3 |
| InChIKey | YTWDBIDVBJENOF-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.88 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|