C28H40O2 — CID 174782396
butane;5,7-ditert-butyl-3-(3,5-dimethylphenyl)-3H-1-benzofuran-2-one (PubChem CID 174782396) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is butane;5,7-ditert-butyl-3-(3,5-dimethylphenyl)-3H-1-benzofuran-2-one.
| Compound Name | butane;5,7-ditert-butyl-3-(3,5-dimethylphenyl)-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 174782396 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | butane;5,7-ditert-butyl-3-(3,5-dimethylphenyl)-3H-1-benzofuran-2-one |
| SMILES | CCCC.Cc1cc(C)cc(C2C(=O)Oc3c2cc(C(C)(C)C)cc3C(C)(C)C)c1 |
| InChI | InChI=1S/C24H30O2.C4H10/c1-14-9-15(2)11-16(10-14)20-18-12-17(23(3,4)5)13-19(24(6,7)8)21(18)26-22(20)25;1-3-4-2/h9-13,20H,1-8H3;3-4H2,1-2H3 |
| InChIKey | PMYZQIZATXLSLA-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|