C22H26O4 — CID 166928805
5,7-ditert-butyl-3-(3,4-dihydroxyphenyl)-3H-1-benzofuran-2-one (PubChem CID 166928805) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 5,7-ditert-butyl-3-(3,4-dihydroxyphenyl)-3H-1-benzofuran-2-one.
| Compound Name | 5,7-ditert-butyl-3-(3,4-dihydroxyphenyl)-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 166928805 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 5,7-ditert-butyl-3-(3,4-dihydroxyphenyl)-3H-1-benzofuran-2-one |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OC(=O)C2c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H26O4/c1-21(2,3)13-10-14-18(12-7-8-16(23)17(24)9-12)20(25)26-19(14)15(11-13)22(4,5)6/h7-11,18,23-24H,1-6H3 |
| InChIKey | UIUMTWBSEUVUJZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|