C30H30O2 — CID 22948125
5,7-ditert-butyl-3-phenanthren-2-yl-3H-1-benzofuran-2-one (PubChem CID 22948125) has the molecular formula C30H30O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5,7-ditert-butyl-3-phenanthren-2-yl-3H-1-benzofuran-2-one.
| Compound Name | 5,7-ditert-butyl-3-phenanthren-2-yl-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 22948125 |
| Molecular Formula | C30H30O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5,7-ditert-butyl-3-phenanthren-2-yl-3H-1-benzofuran-2-one |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OC(=O)C2c1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C30H30O2/c1-29(2,3)21-16-24-26(28(31)32-27(24)25(17-21)30(4,5)6)20-13-14-23-19(15-20)12-11-18-9-7-8-10-22(18)23/h7-17,26H,1-6H3 |
| InChIKey | UWUCJOVTYDHFBJ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|