C12H11BrClFO3 — CID 114042584
(Z)-4-(2-bromo-4-chloro-5-fluorophenoxy)-2-ethylbut-2-enoic acid (PubChem CID 114042584) has the molecular formula C12H11BrClFO3 and a molecular weight of 337.57 g/mol. Its IUPAC name is (Z)-4-(2-bromo-4-chloro-5-fluorophenoxy)-2-ethylbut-2-enoic acid.
| Compound Name | (Z)-4-(2-bromo-4-chloro-5-fluorophenoxy)-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 114042584 |
| Molecular Formula | C12H11BrClFO3 |
| Molecular Weight | 337.57 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | (Z)-4-(2-bromo-4-chloro-5-fluorophenoxy)-2-ethylbut-2-enoic acid |
| SMILES | CC/C(=C/COc1cc(F)c(Cl)cc1Br)C(=O)O |
| InChI | InChI=1S/C12H11BrClFO3/c1-2-7(12(16)17)3-4-18-11-6-10(15)9(14)5-8(11)13/h3,5-6H,2,4H2,1H3,(H,16,17)/b7-3- |
| InChIKey | SVQDJQMQBIPQJT-CLTKARDFSA-N |
| XLogP | 4.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|