C7H2F10O4 — CID 155383254
2,2,3,3-tetrafluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-oxobutanoic acid (PubChem CID 155383254) has the molecular formula C7H2F10O4 and a molecular weight of 340.07 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-oxobutanoic acid.
| Compound Name | 2,2,3,3-tetrafluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155383254 |
| Molecular Formula | C7H2F10O4 |
| Molecular Weight | 340.07 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-oxobutanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H2F10O4/c8-4(9,2(18)19)5(10,11)3(20)21-1(6(12,13)14)7(15,16)17/h1H,(H,18,19) |
| InChIKey | SYOWASJNHKWNJK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|