C25H6F30O10 — CID 138967148
tetrakis(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(hydroxy)methylidene]cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate (PubChem CID 138967148) has the molecular formula C25H6F30O10 and a molecular weight of 1036.25 g/mol. Its IUPAC name is tetrakis(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(hydroxy)methylidene]cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate.
| Compound Name | tetrakis(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(hydroxy)methylidene]cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 138967148 |
| Molecular Formula | C25H6F30O10 |
| Molecular Weight | 1036.25 g/mol |
| Exact Mass | 1035.95 |
| IUPAC Name | tetrakis(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(hydroxy)methylidene]cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)C1=C(C(=O)OC(C(F)(F)F)C(F)(F)F)C(C(=O)OC(C(F)(F)F)C(F)(F)F)=C(C(=O)OC(C(F)(F)F)C(F)(F)F)C1=C(O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H6F30O10/c26-16(27,28)11(17(29,30)31)61-6(56)1-2(7(57)62-12(18(32,33)34)19(35,36)37)4(9(59)64-14(22(44,45)46)23(47,48)49)5(10(60)65-15(24(50,51)52)25(53,54)55)3(1)8(58)63-13(20(38,39)40)21(41,42)43/h11-15,56H |
| InChIKey | KEIAASVBUZQDMG-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.25 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|