C11H12F3O4- — CID 19838858
2,2-dimethyl-3-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylate (PubChem CID 19838858) has the molecular formula C11H12F3O4- and a molecular weight of 265.21 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | 2,2-dimethyl-3-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 19838858 |
| Molecular Formula | C11H12F3O4- |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2,2-dimethyl-3-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]cyclopropane-1-carboxylate |
| SMILES | CC1(C)C(/C=C/C(=O)OCC(F)(F)F)C1C(=O)[O-] |
| InChI | InChI=1S/C11H13F3O4/c1-10(2)6(8(10)9(16)17)3-4-7(15)18-5-11(12,13)14/h3-4,6,8H,5H2,1-2H3,(H,16,17)/p-1/b4-3+ |
| InChIKey | DBCBNGIOEPKILU-ONEGZZNKSA-M |
| XLogP | 0.67 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|