C11H15NO3 — CID 71273424
cis-methyl (1R,3R)-3-[(Z)-2-cyano-2-methoxyethenyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 71273424) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is cis-methyl (1R,3R)-3-[(Z)-2-cyano-2-methoxyethenyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,3R)-3-[(Z)-2-cyano-2-methoxyethenyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71273424 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | cis-methyl (1R,3R)-3-[(Z)-2-cyano-2-methoxyethenyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](/C=C(/C#N)OC)C1(C)C |
| InChI | InChI=1S/C11H15NO3/c1-11(2)8(5-7(6-12)14-3)9(11)10(13)15-4/h5,8-9H,1-4H3/b7-5-/t8-,9+/m1/s1 |
| InChIKey | VFTZMDLHVHUFDX-ZONUIFDKSA-N |
| XLogP | 1.49 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|