C11H19N3O2 — CID 174386643
cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrazine (PubChem CID 174386643) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrazine.
| Compound Name | cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrazine |
|---|---|
| PubChem CID | 174386643 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrazine |
| SMILES | CC(C)=CC1C(C(=O)OC#N)C1(C)C.NN |
| InChI | InChI=1S/C11H15NO2.H4N2/c1-7(2)5-8-9(11(8,3)4)10(13)14-6-12;1-2/h5,8-9H,1-4H3;1-2H2 |
| InChIKey | VGKNTTDQOWPBNP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|