About cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide
cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide (PubChem CID 174384447) has the molecular formula C11H16BrNO2
and a molecular weight of 274.16 g/mol. Its IUPAC name is cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide.
Molecular Properties
| Compound Name | cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide |
| PubChem CID | 174384447 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide |
| SMILES | Br.CC(C)=CC1C(C(=O)OC#N)C1(C)C |
| InChI | InChI=1S/C11H15NO2.BrH/c1-7(2)5-8-9(11(8,3)4)10(13)14-6-12;/h5,8-9H,1-4H3;1H |
| InChIKey | ZTXHMPDQRXMTLJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide?
The IUPAC name of cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide (CID 174384447) is cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide.
What is the SMILES notation for cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide?
The canonical SMILES for cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide is Br.CC(C)=CC1C(C(=O)OC#N)C1(C)C.
What is the InChIKey of cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide?
The InChIKey is ZTXHMPDQRXMTLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.BrH/c1-7(2)5-8-9(11(8,3)4)10(13)14-6-12;/h5,8-9H,1-4H3;1H.
What are the key properties of cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide?
cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide has a molecular weight of 274.16 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyano 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;hydrobromide is sourced from PubChem (CID 174384447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).