C20H22N4O5 — CID 4081281
[4-(6-amino-5-cyano-3-propan-2-yl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)-2,6-dimethoxyphenyl] acetate (PubChem CID 4081281) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is [4-(6-amino-5-cyano-3-propan-2-yl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-(6-amino-5-cyano-3-propan-2-yl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 4081281 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [4-(6-amino-5-cyano-3-propan-2-yl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3n[nH]c(C(C)C)c32)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C20H22N4O5/c1-9(2)17-16-15(12(8-21)19(22)29-20(16)24-23-17)11-6-13(26-4)18(28-10(3)25)14(7-11)27-5/h6-7,9,15H,22H2,1-5H3,(H,23,24) |
| InChIKey | TUJRCNAVJRBJCX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|