C29H31N5O9 — CID 6737906
[4-[6-amino-5-cyano-3-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2,6-dimethoxyphenyl] morpholine-4-carboxylate (PubChem CID 6737906) has the molecular formula C29H31N5O9 and a molecular weight of 593.59 g/mol. Its IUPAC name is [4-[6-amino-5-cyano-3-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2,6-dimethoxyphenyl] morpholine-4-carboxylate.
| Compound Name | [4-[6-amino-5-cyano-3-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2,6-dimethoxyphenyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 6737906 |
| Molecular Formula | C29H31N5O9 |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | [4-[6-amino-5-cyano-3-(3,4,5-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2,6-dimethoxyphenyl] morpholine-4-carboxylate |
| SMILES | COc1cc(-c2[nH]nc3c2C(c2cc(OC)c(OC(=O)N4CCOCC4)c(OC)c2)C(C#N)=C(N)O3)cc(OC)c1OC |
| InChI | InChI=1S/C29H31N5O9/c1-36-18-12-16(13-19(37-2)25(18)40-5)24-23-22(17(14-30)27(31)43-28(23)33-32-24)15-10-20(38-3)26(21(11-15)39-4)42-29(35)34-6-8-41-9-7-34/h10-13,22H,6-9,31H2,1-5H3,(H,32,33) |
| InChIKey | MMTVOZJGCBDGQW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |