C24H22N4O6 — CID 4268414
[4-[6-amino-5-cyano-3-(3-methoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2,6-dimethoxyphenyl] acetate (PubChem CID 4268414) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is [4-[6-amino-5-cyano-3-(3-methoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[6-amino-5-cyano-3-(3-methoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 4268414 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [4-[6-amino-5-cyano-3-(3-methoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cccc(-c2[nH]nc3c2C(c2cc(OC)c(OC(C)=O)c(OC)c2)C(C#N)=C(N)O3)c1 |
| InChI | InChI=1S/C24H22N4O6/c1-12(29)33-22-17(31-3)9-14(10-18(22)32-4)19-16(11-25)23(26)34-24-20(19)21(27-28-24)13-6-5-7-15(8-13)30-2/h5-10,19H,26H2,1-4H3,(H,27,28) |
| InChIKey | WENDJCHIYQRWFM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|