C22H16Cl2N4O4 — CID 1212618
[4-[(4R)-6-amino-5-cyano-3-(3,4-dichlorophenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2-methoxyphenyl] acetate (PubChem CID 1212618) has the molecular formula C22H16Cl2N4O4 and a molecular weight of 471.30 g/mol. Its IUPAC name is [4-[(4R)-6-amino-5-cyano-3-(3,4-dichlorophenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(4R)-6-amino-5-cyano-3-(3,4-dichlorophenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 1212618 |
| Molecular Formula | C22H16Cl2N4O4 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | [4-[(4R)-6-amino-5-cyano-3-(3,4-dichlorophenyl)-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@@H]2C(C#N)=C(N)Oc3n[nH]c(-c4ccc(Cl)c(Cl)c4)c32)ccc1OC(C)=O |
| InChI | InChI=1S/C22H16Cl2N4O4/c1-10(29)31-16-6-4-11(8-17(16)30-2)18-13(9-25)21(26)32-22-19(18)20(27-28-22)12-3-5-14(23)15(24)7-12/h3-8,18H,26H2,1-2H3,(H,27,28)/t18-/m1/s1 |
| InChIKey | COXKUCWVPPCFJV-GOSISDBHSA-N |
| XLogP | 4.54 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|