C24H28O6 — CID 10927765
(3,4-diacetyloxy-5,5,8,8-tetramethyl-6,7-dihydroanthracen-1-yl) acetate (PubChem CID 10927765) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (3,4-diacetyloxy-5,5,8,8-tetramethyl-6,7-dihydroanthracen-1-yl) acetate.
| Compound Name | (3,4-diacetyloxy-5,5,8,8-tetramethyl-6,7-dihydroanthracen-1-yl) acetate |
|---|---|
| PubChem CID | 10927765 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (3,4-diacetyloxy-5,5,8,8-tetramethyl-6,7-dihydroanthracen-1-yl) acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c2cc3c(cc2c1OC(C)=O)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C24H28O6/c1-13(25)28-20-12-21(29-14(2)26)22(30-15(3)27)17-11-19-18(10-16(17)20)23(4,5)8-9-24(19,6)7/h10-12H,8-9H2,1-7H3 |
| InChIKey | VCDRWFVPOQFDFF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|