C25H29NO4 — CID 58934318
[4-[methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]-7-oxocyclohepta-1,3,5-trien-1-yl] acetate (PubChem CID 58934318) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is [4-[methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]-7-oxocyclohepta-1,3,5-trien-1-yl] acetate.
| Compound Name | [4-[methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]-7-oxocyclohepta-1,3,5-trien-1-yl] acetate |
|---|---|
| PubChem CID | 58934318 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [4-[methyl-(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]-7-oxocyclohepta-1,3,5-trien-1-yl] acetate |
| SMILES | CC(=O)Oc1ccc(N(C)C(=O)c2ccc3c(c2)C(C)(C)CCC3(C)C)ccc1=O |
| InChI | InChI=1S/C25H29NO4/c1-16(27)30-22-12-9-18(8-11-21(22)28)26(6)23(29)17-7-10-19-20(15-17)25(4,5)14-13-24(19,2)3/h7-12,15H,13-14H2,1-6H3 |
| InChIKey | KIGOPVSCPONCQK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |