C29H36O4 — CID 70214605
tert-butyl 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enoyloxy]benzoate (PubChem CID 70214605) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is tert-butyl 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enoyloxy]benzoate.
| Compound Name | tert-butyl 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enoyloxy]benzoate |
|---|---|
| PubChem CID | 70214605 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | tert-butyl 4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enoyloxy]benzoate |
| SMILES | CC(=CC(=O)Oc1ccc(C(=O)OC(C)(C)C)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H36O4/c1-19(21-11-14-23-24(18-21)29(7,8)16-15-28(23,5)6)17-25(30)32-22-12-9-20(10-13-22)26(31)33-27(2,3)4/h9-14,17-18H,15-16H2,1-8H3 |
| InChIKey | GPSUTEXKIGVUPX-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|