C19H26O6 — CID 22868491
[(1R,2S)-2-(3-acetyl-2,4,6-trimethoxyphenyl)cyclohexyl] acetate (PubChem CID 22868491) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(1R,2S)-2-(3-acetyl-2,4,6-trimethoxyphenyl)cyclohexyl] acetate.
| Compound Name | [(1R,2S)-2-(3-acetyl-2,4,6-trimethoxyphenyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 22868491 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(1R,2S)-2-(3-acetyl-2,4,6-trimethoxyphenyl)cyclohexyl] acetate |
| SMILES | COc1cc(OC)c([C@@H]2CCCC[C@H]2OC(C)=O)c(OC)c1C(C)=O |
| InChI | InChI=1S/C19H26O6/c1-11(20)17-15(22-3)10-16(23-4)18(19(17)24-5)13-8-6-7-9-14(13)25-12(2)21/h10,13-14H,6-9H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | HVXOEUCVUSRVNV-ZIAGYGMSSA-N |
| XLogP | 3.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |