C25H28FNO7 — CID 175784068
[2-acetyl-6-[(2S,3R)-2-(acetyloxymethyl)-1-methylpyrrolidin-3-yl]-3,5-dimethoxyphenyl] 4-fluorobenzoate (PubChem CID 175784068) has the molecular formula C25H28FNO7 and a molecular weight of 473.50 g/mol. Its IUPAC name is [2-acetyl-6-[(2S,3R)-2-(acetyloxymethyl)-1-methylpyrrolidin-3-yl]-3,5-dimethoxyphenyl] 4-fluorobenzoate.
| Compound Name | [2-acetyl-6-[(2S,3R)-2-(acetyloxymethyl)-1-methylpyrrolidin-3-yl]-3,5-dimethoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 175784068 |
| Molecular Formula | C25H28FNO7 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [2-acetyl-6-[(2S,3R)-2-(acetyloxymethyl)-1-methylpyrrolidin-3-yl]-3,5-dimethoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1cc(OC)c([C@H]2CCN(C)[C@@H]2COC(C)=O)c(OC(=O)c2ccc(F)cc2)c1C(C)=O |
| InChI | InChI=1S/C25H28FNO7/c1-14(28)22-20(31-4)12-21(32-5)23(18-10-11-27(3)19(18)13-33-15(2)29)24(22)34-25(30)16-6-8-17(26)9-7-16/h6-9,12,18-19H,10-11,13H2,1-5H3/t18-,19+/m0/s1 |
| InChIKey | UEDUJENGBBQDLF-RBUKOAKNSA-N |
| XLogP | 3.62 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|