C26H30O14 — CID 101128167
[(2R,3S,4R,6R)-3,4-diacetyloxy-6-(3-acetyl-2,4,6-triacetyloxyphenyl)oxan-2-yl]methyl acetate (PubChem CID 101128167) has the molecular formula C26H30O14 and a molecular weight of 566.51 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-3,4-diacetyloxy-6-(3-acetyl-2,4,6-triacetyloxyphenyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6R)-3,4-diacetyloxy-6-(3-acetyl-2,4,6-triacetyloxyphenyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101128167 |
| Molecular Formula | C26H30O14 |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [(2R,3S,4R,6R)-3,4-diacetyloxy-6-(3-acetyl-2,4,6-triacetyloxyphenyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2c(OC(C)=O)cc(OC(C)=O)c(C(C)=O)c2OC(C)=O)C[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H30O14/c1-11(27)23-18(35-13(3)29)8-19(36-14(4)30)24(26(23)39-17(7)33)20-9-21(37-15(5)31)25(38-16(6)32)22(40-20)10-34-12(2)28/h8,20-22,25H,9-10H2,1-7H3/t20-,21-,22-,25+/m1/s1 |
| InChIKey | MOZTYWAOGMXMKJ-XAISMOLKSA-N |
| XLogP | 1.92 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|