C19H28O7 — CID 11210845
[(1R,4R,6R,8R,9S,10S,11S)-10-acetyloxy-6-formyl-1-methyl-9-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-8-yl] acetate (PubChem CID 11210845) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is [(1R,4R,6R,8R,9S,10S,11S)-10-acetyloxy-6-formyl-1-methyl-9-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-8-yl] acetate.
| Compound Name | [(1R,4R,6R,8R,9S,10S,11S)-10-acetyloxy-6-formyl-1-methyl-9-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-8-yl] acetate |
|---|---|
| PubChem CID | 11210845 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [(1R,4R,6R,8R,9S,10S,11S)-10-acetyloxy-6-formyl-1-methyl-9-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](C(C)C)[C@H](OC(C)=O)C[C@@]2(C=O)O[C@@H]2CC[C@@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C19H28O7/c1-10(2)15-13(23-11(3)21)8-19(9-20)14(25-19)6-7-18(5)17(26-18)16(15)24-12(4)22/h9-10,13-17H,6-8H2,1-5H3/t13-,14-,15+,16+,17+,18-,19+/m1/s1 |
| InChIKey | FZHYVARJPXGTKX-OHNZXXHYSA-N |
| XLogP | 1.80 |
| TPSA | 94.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|