C12H21NO2 — CID 21498552
(1,3,3-trimethyl-2-azabicyclo[2.2.2]octan-5-yl) acetate (PubChem CID 21498552) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (1,3,3-trimethyl-2-azabicyclo[2.2.2]octan-5-yl) acetate.
| Compound Name | (1,3,3-trimethyl-2-azabicyclo[2.2.2]octan-5-yl) acetate |
|---|---|
| PubChem CID | 21498552 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (1,3,3-trimethyl-2-azabicyclo[2.2.2]octan-5-yl) acetate |
| SMILES | CC(=O)OC1CC2(C)CCC1C(C)(C)N2 |
| InChI | InChI=1S/C12H21NO2/c1-8(14)15-10-7-12(4)6-5-9(10)11(2,3)13-12/h9-10,13H,5-7H2,1-4H3 |
| InChIKey | JYTCWIMZPREZKL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |